C20H20F6N4O2 — CID 86666472
5-amino-4-(2,2-difluoroethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 86666472) has the molecular formula C20H20F6N4O2 and a molecular weight of 462.39 g/mol. Its IUPAC name is 5-amino-4-(2,2-difluoroethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 5-amino-4-(2,2-difluoroethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 86666472 |
| Molecular Formula | C20H20F6N4O2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-amino-4-(2,2-difluoroethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Nc1cc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c(N2CC[C@@H](F)C2)cc1NCC(F)F |
| InChI | InChI=1S/C20H20F6N4O2/c21-11-5-6-30(10-11)17-8-16(28-9-18(22)23)15(27)7-14(17)19(31)29-12-1-3-13(4-2-12)32-20(24,25)26/h1-4,7-8,11,18,28H,5-6,9-10,27H2,(H,29,31)/t11-/m1/s1 |
| InChIKey | MCMYVUSWTAMASG-LLVKDONJSA-N |
| XLogP | 4.64 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|