C16H11ClF5N3O4 — CID 86666470
2-chloro-4-(2,2-difluoroethylamino)-5-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 86666470) has the molecular formula C16H11ClF5N3O4 and a molecular weight of 439.72 g/mol. Its IUPAC name is 2-chloro-4-(2,2-difluoroethylamino)-5-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-chloro-4-(2,2-difluoroethylamino)-5-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 86666470 |
| Molecular Formula | C16H11ClF5N3O4 |
| Molecular Weight | 439.72 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 2-chloro-4-(2,2-difluoroethylamino)-5-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cc([N+](=O)[O-])c(NCC(F)F)cc1Cl |
| InChI | InChI=1S/C16H11ClF5N3O4/c17-11-6-12(23-7-14(18)19)13(25(27)28)5-10(11)15(26)24-8-1-3-9(4-2-8)29-16(20,21)22/h1-6,14,23H,7H2,(H,24,26) |
| InChIKey | RIUPSXXTEOMDNU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|