C15H18F5N3O2 — CID 129370496
1-(2,2-difluoroethyl)-3-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea (PubChem CID 129370496) has the molecular formula C15H18F5N3O2 and a molecular weight of 367.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(2,2-difluoroethyl)-3-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129370496 |
| Molecular Formula | C15H18F5N3O2 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NCC(F)F)NC[C@@H]1CCN(c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H18F5N3O2/c16-13(17)8-22-14(24)21-7-10-5-6-23(9-10)11-1-3-12(4-2-11)25-15(18,19)20/h1-4,10,13H,5-9H2,(H2,21,22,24)/t10-/m0/s1 |
| InChIKey | JLDANBPADPRRFN-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|