C20H20ClF3N2O3 — CID 166192634
2-(4-chlorophenoxy)-N-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]acetamide (PubChem CID 166192634) has the molecular formula C20H20ClF3N2O3 and a molecular weight of 428.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 166192634 |
| Molecular Formula | C20H20ClF3N2O3 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCC1CCN(c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H20ClF3N2O3/c21-15-1-5-17(6-2-15)28-13-19(27)25-11-14-9-10-26(12-14)16-3-7-18(8-4-16)29-20(22,23)24/h1-8,14H,9-13H2,(H,25,27) |
| InChIKey | YCIQSMGGQHFUFS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|