C18H23F3N2O3 — CID 97012164
N-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]oxane-4-carboxamide (PubChem CID 97012164) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 97012164 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[[(3S)-1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]oxane-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCN(c2ccc(OC(F)(F)F)cc2)C1)C1CCOCC1 |
| InChI | InChI=1S/C18H23F3N2O3/c19-18(20,21)26-16-3-1-15(2-4-16)23-8-5-13(12-23)11-22-17(24)14-6-9-25-10-7-14/h1-4,13-14H,5-12H2,(H,22,24)/t13-/m0/s1 |
| InChIKey | SDPKPHXXXIDMNV-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|