C17H20F3N5O3 — CID 126805596
1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea (PubChem CID 126805596) has the molecular formula C17H20F3N5O3 and a molecular weight of 399.37 g/mol. Its IUPAC name is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 126805596 |
| Molecular Formula | C17H20F3N5O3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[[1-[4-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methyl]urea |
| SMILES | Cc1noc(CNC(=O)NCC2CCN(c3ccc(OC(F)(F)F)cc3)C2)n1 |
| InChI | InChI=1S/C17H20F3N5O3/c1-11-23-15(28-24-11)9-22-16(26)21-8-12-6-7-25(10-12)13-2-4-14(5-3-13)27-17(18,19)20/h2-5,12H,6-10H2,1H3,(H2,21,22,26) |
| InChIKey | IYBZKBAMBZBXEV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|