C11H14ClF2N3O — CID 67978209
5-amino-2-chloro-N-(2,2-difluoropropyl)-4-(methylamino)benzamide (PubChem CID 67978209) has the molecular formula C11H14ClF2N3O and a molecular weight of 277.70 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(2,2-difluoropropyl)-4-(methylamino)benzamide.
| Compound Name | 5-amino-2-chloro-N-(2,2-difluoropropyl)-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 67978209 |
| Molecular Formula | C11H14ClF2N3O |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-amino-2-chloro-N-(2,2-difluoropropyl)-4-(methylamino)benzamide |
| SMILES | CNc1cc(Cl)c(C(=O)NCC(C)(F)F)cc1N |
| InChI | InChI=1S/C11H14ClF2N3O/c1-11(13,14)5-17-10(18)6-3-8(15)9(16-2)4-7(6)12/h3-4,16H,5,15H2,1-2H3,(H,17,18) |
| InChIKey | VLXQWPLDLNPMEC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|