About pyrene-4-carbonyl chloride
pyrene-4-carbonyl chloride (PubChem CID 71349063) has the molecular formula C17H9ClO
and a molecular weight of 264.71 g/mol. Its IUPAC name is pyrene-4-carbonyl chloride.
Molecular Properties
| Compound Name | pyrene-4-carbonyl chloride |
| PubChem CID | 71349063 |
| Molecular Formula | C17H9ClO |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | pyrene-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C17H9ClO/c18-17(19)14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H |
| InChIKey | WVJYHGOXRPQEBM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene-4-carbonyl chloride?
The IUPAC name of pyrene-4-carbonyl chloride (CID 71349063) is pyrene-4-carbonyl chloride.
What is the SMILES notation for pyrene-4-carbonyl chloride?
The canonical SMILES for pyrene-4-carbonyl chloride is O=C(Cl)c1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of pyrene-4-carbonyl chloride?
The InChIKey is WVJYHGOXRPQEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClO/c18-17(19)14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H.
What are the key properties of pyrene-4-carbonyl chloride?
pyrene-4-carbonyl chloride has a molecular weight of 264.71 g/mol, XLogP of 4.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-4-carbonyl chloride is sourced from PubChem (CID 71349063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).