pyrene-4-carbonyl chloride

C17H9ClO — CID 71349063

IUPACpyrene-4-carbonyl chloride
SMILESO=C(Cl)c1cc2cccc3ccc4cccc1c4c32
InChIInChI=1S/C17H9ClO/c18-17(19)14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H
InChIKeyWVJYHGOXRPQEBM-UHFFFAOYSA-N
MW264.71 g/mol
LogP4.96
Rot. Bonds1

About pyrene-4-carbonyl chloride

pyrene-4-carbonyl chloride (PubChem CID 71349063) has the molecular formula C17H9ClO and a molecular weight of 264.71 g/mol. Its IUPAC name is pyrene-4-carbonyl chloride.

Molecular Properties

Compound Namepyrene-4-carbonyl chloride
PubChem CID71349063
Molecular FormulaC17H9ClO
Molecular Weight264.71 g/mol
Exact Mass264.03
IUPAC Namepyrene-4-carbonyl chloride
SMILESO=C(Cl)c1cc2cccc3ccc4cccc1c4c32
InChIInChI=1S/C17H9ClO/c18-17(19)14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H
InChIKeyWVJYHGOXRPQEBM-UHFFFAOYSA-N
XLogP4.96
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.71
LogP ≤ 54.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze pyrene-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrene-4-carbonyl chloride?
The IUPAC name of pyrene-4-carbonyl chloride (CID 71349063) is pyrene-4-carbonyl chloride.
What is the SMILES notation for pyrene-4-carbonyl chloride?
The canonical SMILES for pyrene-4-carbonyl chloride is O=C(Cl)c1cc2cccc3ccc4cccc1c4c32.
What is the InChIKey of pyrene-4-carbonyl chloride?
The InChIKey is WVJYHGOXRPQEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClO/c18-17(19)14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H.
What are the key properties of pyrene-4-carbonyl chloride?
pyrene-4-carbonyl chloride has a molecular weight of 264.71 g/mol, XLogP of 4.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene-4-carbonyl chloride is sourced from PubChem (CID 71349063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).