chrysene-6,12-dicarbonyl chloride

C20H10Cl2O2 — CID 139611944

IUPACchrysene-6,12-dicarbonyl chloride
SMILESO=C(Cl)c1cc2c3ccccc3c(C(=O)Cl)cc2c2ccccc12
InChIInChI=1S/C20H10Cl2O2/c21-19(23)17-10-16-12-6-2-4-8-14(12)18(20(22)24)9-15(16)11-5-1-3-7-13(11)17/h1-10H
InChIKeyFXFAQVSDADKGRQ-UHFFFAOYSA-N
MW353.20 g/mol
LogP5.90
Rot. Bonds2

About chrysene-6,12-dicarbonyl chloride

chrysene-6,12-dicarbonyl chloride (PubChem CID 139611944) has the molecular formula C20H10Cl2O2 and a molecular weight of 353.20 g/mol. Its IUPAC name is chrysene-6,12-dicarbonyl chloride.

Molecular Properties

Compound Namechrysene-6,12-dicarbonyl chloride
PubChem CID139611944
Molecular FormulaC20H10Cl2O2
Molecular Weight353.20 g/mol
Exact Mass352.01
IUPAC Namechrysene-6,12-dicarbonyl chloride
SMILESO=C(Cl)c1cc2c3ccccc3c(C(=O)Cl)cc2c2ccccc12
InChIInChI=1S/C20H10Cl2O2/c21-19(23)17-10-16-12-6-2-4-8-14(12)18(20(22)24)9-15(16)11-5-1-3-7-13(11)17/h1-10H
InChIKeyFXFAQVSDADKGRQ-UHFFFAOYSA-N
XLogP5.90
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500353.20
LogP ≤ 55.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze chrysene-6,12-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chrysene-6,12-dicarbonyl chloride?
The IUPAC name of chrysene-6,12-dicarbonyl chloride (CID 139611944) is chrysene-6,12-dicarbonyl chloride.
What is the SMILES notation for chrysene-6,12-dicarbonyl chloride?
The canonical SMILES for chrysene-6,12-dicarbonyl chloride is O=C(Cl)c1cc2c3ccccc3c(C(=O)Cl)cc2c2ccccc12.
What is the InChIKey of chrysene-6,12-dicarbonyl chloride?
The InChIKey is FXFAQVSDADKGRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl2O2/c21-19(23)17-10-16-12-6-2-4-8-14(12)18(20(22)24)9-15(16)11-5-1-3-7-13(11)17/h1-10H.
What are the key properties of chrysene-6,12-dicarbonyl chloride?
chrysene-6,12-dicarbonyl chloride has a molecular weight of 353.20 g/mol, XLogP of 5.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene-6,12-dicarbonyl chloride is sourced from PubChem (CID 139611944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).