About chrysene-6,12-dicarbonyl chloride
chrysene-6,12-dicarbonyl chloride (PubChem CID 139611944) has the molecular formula C20H10Cl2O2
and a molecular weight of 353.20 g/mol. Its IUPAC name is chrysene-6,12-dicarbonyl chloride.
Molecular Properties
| Compound Name | chrysene-6,12-dicarbonyl chloride |
| PubChem CID | 139611944 |
| Molecular Formula | C20H10Cl2O2 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | chrysene-6,12-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc2c3ccccc3c(C(=O)Cl)cc2c2ccccc12 |
| InChI | InChI=1S/C20H10Cl2O2/c21-19(23)17-10-16-12-6-2-4-8-14(12)18(20(22)24)9-15(16)11-5-1-3-7-13(11)17/h1-10H |
| InChIKey | FXFAQVSDADKGRQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene-6,12-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene-6,12-dicarbonyl chloride?
The IUPAC name of chrysene-6,12-dicarbonyl chloride (CID 139611944) is chrysene-6,12-dicarbonyl chloride.
What is the SMILES notation for chrysene-6,12-dicarbonyl chloride?
The canonical SMILES for chrysene-6,12-dicarbonyl chloride is O=C(Cl)c1cc2c3ccccc3c(C(=O)Cl)cc2c2ccccc12.
What is the InChIKey of chrysene-6,12-dicarbonyl chloride?
The InChIKey is FXFAQVSDADKGRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl2O2/c21-19(23)17-10-16-12-6-2-4-8-14(12)18(20(22)24)9-15(16)11-5-1-3-7-13(11)17/h1-10H.
What are the key properties of chrysene-6,12-dicarbonyl chloride?
chrysene-6,12-dicarbonyl chloride has a molecular weight of 353.20 g/mol, XLogP of 5.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene-6,12-dicarbonyl chloride is sourced from PubChem (CID 139611944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).