C22H10O4-2 — CID 22639636
perylene-1,2-dicarboxylate (PubChem CID 22639636) has the molecular formula C22H10O4-2 and a molecular weight of 338.32 g/mol. Its IUPAC name is perylene-1,2-dicarboxylate.
| Compound Name | perylene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22639636 |
| Molecular Formula | C22H10O4-2 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | perylene-1,2-dicarboxylate |
| SMILES | O=C([O-])c1cc2cccc3c4cccc5cccc(c(c1C(=O)[O-])c23)c54 |
| InChI | InChI=1S/C22H12O4/c23-21(24)16-10-12-6-3-8-14-13-7-1-4-11-5-2-9-15(17(11)13)19(18(12)14)20(16)22(25)26/h1-10H,(H,23,24)(H,25,26)/p-2 |
| InChIKey | KIZSMODMWVZSNT-UHFFFAOYSA-L |
| XLogP | 2.46 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|