C44H22O16 — CID 162083064
perylene-1,2,3,4-tetracarboxylic acid;pyrene-1,2,3,4-tetracarboxylic acid (PubChem CID 162083064) has the molecular formula C44H22O16 and a molecular weight of 806.64 g/mol. Its IUPAC name is perylene-1,2,3,4-tetracarboxylic acid;pyrene-1,2,3,4-tetracarboxylic acid.
| Compound Name | perylene-1,2,3,4-tetracarboxylic acid;pyrene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 162083064 |
| Molecular Formula | C44H22O16 |
| Molecular Weight | 806.64 g/mol |
| Exact Mass | 806.09 |
| IUPAC Name | perylene-1,2,3,4-tetracarboxylic acid;pyrene-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)c1c(C(=O)O)c2c(C(=O)O)ccc3c4cccc5cccc(c(c1C(=O)O)c23)c54.O=C(O)c1c(C(=O)O)c2ccc3cccc4cc(C(=O)O)c(c1C(=O)O)c2c34 |
| InChI | InChI=1S/C24H12O8.C20H10O8/c25-21(26)13-8-7-11-10-5-1-3-9-4-2-6-12(14(9)10)16-15(11)17(13)19(23(29)30)20(24(31)32)18(16)22(27)28;21-17(22)10-6-8-3-1-2-7-4-5-9-12(11(7)8)13(10)15(19(25)26)16(20(27)28)14(9)18(23)24/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32);1-6H,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | ZCPAJDFAPZLYCO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|