C22H15N3O10 — CID 174823483
carbamoylurea;pyrene-1,2,3,4-tetracarboxylic acid (PubChem CID 174823483) has the molecular formula C22H15N3O10 and a molecular weight of 481.37 g/mol. Its IUPAC name is carbamoylurea;pyrene-1,2,3,4-tetracarboxylic acid.
| Compound Name | carbamoylurea;pyrene-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 174823483 |
| Molecular Formula | C22H15N3O10 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | carbamoylurea;pyrene-1,2,3,4-tetracarboxylic acid |
| SMILES | NC(=O)NC(N)=O.O=C(O)c1c(C(=O)O)c2ccc3cccc4cc(C(=O)O)c(c1C(=O)O)c2c34 |
| InChI | InChI=1S/C20H10O8.C2H5N3O2/c21-17(22)10-6-8-3-1-2-7-4-5-9-12(11(7)8)13(10)15(19(25)26)16(20(27)28)14(9)18(23)24;3-1(6)5-2(4)7/h1-6H,(H,21,22)(H,23,24)(H,25,26)(H,27,28);(H5,3,4,5,6,7) |
| InChIKey | CPAQUKZBUKXISP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 247.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|