C28H13KO8 — CID 175062872
potassium;coronene-1,2,3,4-tetracarboxylic acid;hydride (PubChem CID 175062872) has the molecular formula C28H13KO8 and a molecular weight of 516.50 g/mol. Its IUPAC name is potassium;coronene-1,2,3,4-tetracarboxylic acid;hydride.
| Compound Name | potassium;coronene-1,2,3,4-tetracarboxylic acid;hydride |
|---|---|
| PubChem CID | 175062872 |
| Molecular Formula | C28H13KO8 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | potassium;coronene-1,2,3,4-tetracarboxylic acid;hydride |
| SMILES | O=C(O)c1c(C(=O)O)c2c(C(=O)O)c(C(=O)O)c3ccc4ccc5ccc6ccc1c1c6c5c4c3c21.[H-].[K+] |
| InChI | InChI=1S/C28H12O8.K.H/c29-25(30)19-12-7-5-10-3-1-9-2-4-11-6-8-13-18-16(11)14(9)15(10)17(12)21(18)22(23(19)27(33)34)24(28(35)36)20(13)26(31)32;;/h1-8H,(H,29,30)(H,31,32)(H,33,34)(H,35,36);;/q;+1;-1 |
| InChIKey | XTBRFAIWIRJOOM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|