C24H14O4 — CID 11337531
dimethyl hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene-2,3-dicarboxylate (PubChem CID 11337531) has the molecular formula C24H14O4 and a molecular weight of 366.37 g/mol. Its IUPAC name is dimethyl hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene-2,3-dicarboxylate.
| Compound Name | dimethyl hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11337531 |
| Molecular Formula | C24H14O4 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | dimethyl hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3ccc4ccc5ccc1c1c5c4c3c21 |
| InChI | InChI=1S/C24H14O4/c1-27-23(25)21-14-9-7-12-5-3-11-4-6-13-8-10-15(22(21)24(26)28-2)20-18(13)16(11)17(12)19(14)20/h3-10H,1-2H3 |
| InChIKey | RCNGFZVFZCKACN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|