C19H14BF4NO4 — CID 139117302
dimethyl 1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene-2,3-dicarboxylate tetrafluoroborate (PubChem CID 139117302) has the molecular formula C19H14BF4NO4 and a molecular weight of 407.13 g/mol. Its IUPAC name is dimethyl 1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene-2,3-dicarboxylate tetrafluoroborate.
| Compound Name | dimethyl 1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene-2,3-dicarboxylate tetrafluoroborate |
|---|---|
| PubChem CID | 139117302 |
| Molecular Formula | C19H14BF4NO4 |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | dimethyl 1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene-2,3-dicarboxylate tetrafluoroborate |
| SMILES | COC(=O)c1c(C(=O)OC)[n+]2cccc3ccc4cccc1c4c32.F[B-](F)(F)F |
| InChI | InChI=1S/C19H14NO4.BF4/c1-23-18(21)15-13-7-3-5-11-8-9-12-6-4-10-20(16(12)14(11)13)17(15)19(22)24-2;2-1(3,4)5/h3-10H,1-2H3;/q+1;-1 |
| InChIKey | BOGFOWDXTGYLHJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|