C48H26O8 — CID 132916145
4-[3,8,9-tris(4-carboxyphenyl)-2-hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaenyl]benzoic acid (PubChem CID 132916145) has the molecular formula C48H26O8 and a molecular weight of 730.73 g/mol. Its IUPAC name is 4-[3,8,9-tris(4-carboxyphenyl)-2-hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaenyl]benzoic acid.
| Compound Name | 4-[3,8,9-tris(4-carboxyphenyl)-2-hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaenyl]benzoic acid |
|---|---|
| PubChem CID | 132916145 |
| Molecular Formula | C48H26O8 |
| Molecular Weight | 730.73 g/mol |
| Exact Mass | 730.16 |
| IUPAC Name | 4-[3,8,9-tris(4-carboxyphenyl)-2-hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(-c3ccc(C(=O)O)cc3)c3ccc4c(-c5ccc(C(=O)O)cc5)c(-c5ccc(C(=O)O)cc5)c5ccc6ccc2c2c6c5c4c32)cc1 |
| InChI | InChI=1S/C48H26O8/c49-45(50)28-9-1-23(2-10-28)36-32-19-17-27-18-20-33-37(24-3-11-29(12-4-24)46(51)52)39(26-7-15-31(16-8-26)48(55)56)35-22-21-34(43-41(32)40(27)42(33)44(35)43)38(36)25-5-13-30(14-6-25)47(53)54/h1-22H,(H,49,50)(H,51,52)(H,53,54)(H,55,56) |
| InChIKey | OKDMLNVELVQDMU-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.73 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|