C68H42O8 — CID 122386129
4-[4-[3,6,8-tris[4-(4-carboxyphenyl)phenyl]pyren-1-yl]phenyl]benzoic acid (PubChem CID 122386129) has the molecular formula C68H42O8 and a molecular weight of 987.08 g/mol. Its IUPAC name is 4-[4-[3,6,8-tris[4-(4-carboxyphenyl)phenyl]pyren-1-yl]phenyl]benzoic acid.
| Compound Name | 4-[4-[3,6,8-tris[4-(4-carboxyphenyl)phenyl]pyren-1-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 122386129 |
| Molecular Formula | C68H42O8 |
| Molecular Weight | 987.08 g/mol |
| Exact Mass | 986.29 |
| IUPAC Name | 4-[4-[3,6,8-tris[4-(4-carboxyphenyl)phenyl]pyren-1-yl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c4ccc5c(-c6ccc(-c7ccc(C(=O)O)cc7)cc6)cc(-c6ccc(-c7ccc(C(=O)O)cc7)cc6)c6ccc3c4c65)cc2)cc1 |
| InChI | InChI=1S/C68H42O8/c69-65(70)51-25-9-43(10-26-51)39-1-17-47(18-2-39)59-37-60(48-19-3-40(4-20-48)44-11-27-52(28-12-44)66(71)72)56-35-36-58-62(50-23-7-42(8-24-50)46-15-31-54(32-16-46)68(75)76)38-61(57-34-33-55(59)63(56)64(57)58)49-21-5-41(6-22-49)45-13-29-53(30-14-45)67(73)74/h1-38H,(H,69,70)(H,71,72)(H,73,74)(H,75,76) |
| InChIKey | SQBFYRAFELCJFN-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.08 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|