C30H14O8 — CID 159720700
heptacyclo[16.8.0.02,11.03,8.04,25.012,17.021,26]hexacosa-1(26),2(11),3,5,7,9,12(17),13,15,18,20,22,24-tridecaene-5,6,16,19-tetracarboxylic acid (PubChem CID 159720700) has the molecular formula C30H14O8 and a molecular weight of 502.43 g/mol. Its IUPAC name is heptacyclo[16.8.0.02,11.03,8.04,25.012,17.021,26]hexacosa-1(26),2(11),3,5,7,9,12(17),13,15,18,20,22,24-tridecaene-5,6,16,19-tetracarboxylic acid.
| Compound Name | heptacyclo[16.8.0.02,11.03,8.04,25.012,17.021,26]hexacosa-1(26),2(11),3,5,7,9,12(17),13,15,18,20,22,24-tridecaene-5,6,16,19-tetracarboxylic acid |
|---|---|
| PubChem CID | 159720700 |
| Molecular Formula | C30H14O8 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | heptacyclo[16.8.0.02,11.03,8.04,25.012,17.021,26]hexacosa-1(26),2(11),3,5,7,9,12(17),13,15,18,20,22,24-tridecaene-5,6,16,19-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2ccc3c4cccc(C(=O)O)c4c4c(C(=O)O)cc5cccc6c(c1C(=O)O)c2c3c4c56 |
| InChI | InChI=1S/C30H14O8/c31-27(32)16-6-2-4-13-14-8-7-12-10-18(29(35)36)25(30(37)38)23-15-5-1-3-11-9-17(28(33)34)24(21(13)16)26(19(11)15)22(14)20(12)23/h1-10H,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | MZZNKAONXDRZGM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|