C32H30N2O10 — CID 148921096
1-carbamoyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylcarbamoyl]perylene-3,4-dicarboxylic acid (PubChem CID 148921096) has the molecular formula C32H30N2O10 and a molecular weight of 602.60 g/mol. Its IUPAC name is 1-carbamoyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylcarbamoyl]perylene-3,4-dicarboxylic acid.
| Compound Name | 1-carbamoyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylcarbamoyl]perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 148921096 |
| Molecular Formula | C32H30N2O10 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 1-carbamoyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylcarbamoyl]perylene-3,4-dicarboxylic acid |
| SMILES | NC(=O)c1c(C(=O)NCCOCCOCCOCCO)c(C(=O)O)c2c(C(=O)O)ccc3c4cccc5cccc(c1c23)c54 |
| InChI | InChI=1S/C32H30N2O10/c33-29(36)26-24-20-6-2-4-17-3-1-5-18(22(17)20)19-7-8-21(31(38)39)25(23(19)24)28(32(40)41)27(26)30(37)34-9-11-42-13-15-44-16-14-43-12-10-35/h1-8,35H,9-16H2,(H2,33,36)(H,34,37)(H,38,39)(H,40,41) |
| InChIKey | FSVQOFOCPVIQGI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 194.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|