methanimine;perylene-3,4-dicarbonyl chloride

C24H16Cl2N2O2 — CID 175017468

IUPACmethanimine;perylene-3,4-dicarbonyl chloride
SMILESO=C(Cl)c1ccc2c3cccc4cccc(c5ccc(C(=O)Cl)c1c25)c43.[H]N=C.[H]N=C
InChIInChI=1S/C22H10Cl2O2.2CH3N/c23-21(25)16-9-7-14-12-5-1-3-11-4-2-6-13(18(11)12)15-8-10-17(22(24)26)20(16)19(14)15;2*1-2/h1-10H;2*2H,1H2
InChIKeyNDCBUGBLXNIOOX-UHFFFAOYSA-N
MW435.31 g/mol
LogP7.03
Rot. Bonds2

About methanimine;perylene-3,4-dicarbonyl chloride

methanimine;perylene-3,4-dicarbonyl chloride (PubChem CID 175017468) has the molecular formula C24H16Cl2N2O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is methanimine;perylene-3,4-dicarbonyl chloride.

Molecular Properties

Compound Namemethanimine;perylene-3,4-dicarbonyl chloride
PubChem CID175017468
Molecular FormulaC24H16Cl2N2O2
Molecular Weight435.31 g/mol
Exact Mass434.06
IUPAC Namemethanimine;perylene-3,4-dicarbonyl chloride
SMILESO=C(Cl)c1ccc2c3cccc4cccc(c5ccc(C(=O)Cl)c1c25)c43.[H]N=C.[H]N=C
InChIInChI=1S/C22H10Cl2O2.2CH3N/c23-21(25)16-9-7-14-12-5-1-3-11-4-2-6-13(18(11)12)15-8-10-17(22(24)26)20(16)19(14)15;2*1-2/h1-10H;2*2H,1H2
InChIKeyNDCBUGBLXNIOOX-UHFFFAOYSA-N
XLogP7.03
TPSA81.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500435.31
LogP ≤ 57.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze methanimine;perylene-3,4-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methanimine;perylene-3,4-dicarbonyl chloride?
The IUPAC name of methanimine;perylene-3,4-dicarbonyl chloride (CID 175017468) is methanimine;perylene-3,4-dicarbonyl chloride.
What is the SMILES notation for methanimine;perylene-3,4-dicarbonyl chloride?
The canonical SMILES for methanimine;perylene-3,4-dicarbonyl chloride is O=C(Cl)c1ccc2c3cccc4cccc(c5ccc(C(=O)Cl)c1c25)c43.[H]N=C.[H]N=C.
What is the InChIKey of methanimine;perylene-3,4-dicarbonyl chloride?
The InChIKey is NDCBUGBLXNIOOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H10Cl2O2.2CH3N/c23-21(25)16-9-7-14-12-5-1-3-11-4-2-6-13(18(11)12)15-8-10-17(22(24)26)20(16)19(14)15;2*1-2/h1-10H;2*2H,1H2.
What are the key properties of methanimine;perylene-3,4-dicarbonyl chloride?
methanimine;perylene-3,4-dicarbonyl chloride has a molecular weight of 435.31 g/mol, XLogP of 7.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;perylene-3,4-dicarbonyl chloride is sourced from PubChem (CID 175017468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).