C24H16Cl2N2O2 — CID 175017468
methanimine;perylene-3,4-dicarbonyl chloride (PubChem CID 175017468) has the molecular formula C24H16Cl2N2O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is methanimine;perylene-3,4-dicarbonyl chloride.
| Compound Name | methanimine;perylene-3,4-dicarbonyl chloride |
|---|---|
| PubChem CID | 175017468 |
| Molecular Formula | C24H16Cl2N2O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | methanimine;perylene-3,4-dicarbonyl chloride |
| SMILES | O=C(Cl)c1ccc2c3cccc4cccc(c5ccc(C(=O)Cl)c1c25)c43.[H]N=C.[H]N=C |
| InChI | InChI=1S/C22H10Cl2O2.2CH3N/c23-21(25)16-9-7-14-12-5-1-3-11-4-2-6-13(18(11)12)15-8-10-17(22(24)26)20(16)19(14)15;2*1-2/h1-10H;2*2H,1H2 |
| InChIKey | NDCBUGBLXNIOOX-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|