C34H34N2O6 — CID 159227382
9,10-dicarbamoyl-7,8-dipentylperylene-3,4-dicarboxylic acid (PubChem CID 159227382) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is 9,10-dicarbamoyl-7,8-dipentylperylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-dicarbamoyl-7,8-dipentylperylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 159227382 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 9,10-dicarbamoyl-7,8-dipentylperylene-3,4-dicarboxylic acid |
| SMILES | CCCCCc1c(C(N)=O)c2c(C(N)=O)ccc3c4ccc(C(=O)O)c5c(C(=O)O)ccc(c(c1CCCCC)c23)c54 |
| InChI | InChI=1S/C34H34N2O6/c1-3-5-7-9-17-18(10-8-6-4-2)30(32(36)38)29-22(31(35)37)14-11-20-19-12-15-23(33(39)40)27-24(34(41)42)16-13-21(25(19)27)26(17)28(20)29/h11-16H,3-10H2,1-2H3,(H2,35,37)(H2,36,38)(H,39,40)(H,41,42) |
| InChIKey | KSLPUQYUJLXVCM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|