C14H9ClN2O6 — CID 150458904
5,8-dicarbamoyl-6-chloronaphthalene-1,4-dicarboxylic acid (PubChem CID 150458904) has the molecular formula C14H9ClN2O6 and a molecular weight of 336.69 g/mol. Its IUPAC name is 5,8-dicarbamoyl-6-chloronaphthalene-1,4-dicarboxylic acid.
| Compound Name | 5,8-dicarbamoyl-6-chloronaphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 150458904 |
| Molecular Formula | C14H9ClN2O6 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 5,8-dicarbamoyl-6-chloronaphthalene-1,4-dicarboxylic acid |
| SMILES | NC(=O)c1cc(Cl)c(C(N)=O)c2c(C(=O)O)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C14H9ClN2O6/c15-7-3-6(11(16)18)8-4(13(20)21)1-2-5(14(22)23)9(8)10(7)12(17)19/h1-3H,(H2,16,18)(H2,17,19)(H,20,21)(H,22,23) |
| InChIKey | HPJIBXDEKPLINE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |