C24H10Cl4O7 — CID 88778420
8-(8-carboxy-4,5-dichloronaphthalene-1-carbonyl)oxycarbonyl-4,5-dichloronaphthalene-1-carboxylic acid (PubChem CID 88778420) has the molecular formula C24H10Cl4O7 and a molecular weight of 552.15 g/mol. Its IUPAC name is 8-(8-carboxy-4,5-dichloronaphthalene-1-carbonyl)oxycarbonyl-4,5-dichloronaphthalene-1-carboxylic acid.
| Compound Name | 8-(8-carboxy-4,5-dichloronaphthalene-1-carbonyl)oxycarbonyl-4,5-dichloronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 88778420 |
| Molecular Formula | C24H10Cl4O7 |
| Molecular Weight | 552.15 g/mol |
| Exact Mass | 549.92 |
| IUPAC Name | 8-(8-carboxy-4,5-dichloronaphthalene-1-carbonyl)oxycarbonyl-4,5-dichloronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c2c(Cl)ccc(C(=O)OC(=O)c3ccc(Cl)c4c(Cl)ccc(C(=O)O)c34)c12 |
| InChI | InChI=1S/C24H10Cl4O7/c25-13-5-1-9(21(29)30)17-11(3-7-15(27)19(13)17)23(33)35-24(34)12-4-8-16(28)20-14(26)6-2-10(18(12)20)22(31)32/h1-8H,(H,29,30)(H,31,32) |
| InChIKey | VIKZQPVCPLPJGB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.15 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|