C17H10Cl2O7 — CID 175425724
4-(4-carboxy-2-methylbenzoyl)oxycarbonyl-2,5-dichlorobenzoic acid (PubChem CID 175425724) has the molecular formula C17H10Cl2O7 and a molecular weight of 397.17 g/mol. Its IUPAC name is 4-(4-carboxy-2-methylbenzoyl)oxycarbonyl-2,5-dichlorobenzoic acid.
| Compound Name | 4-(4-carboxy-2-methylbenzoyl)oxycarbonyl-2,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 175425724 |
| Molecular Formula | C17H10Cl2O7 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 4-(4-carboxy-2-methylbenzoyl)oxycarbonyl-2,5-dichlorobenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1C(=O)OC(=O)c1cc(Cl)c(C(=O)O)cc1Cl |
| InChI | InChI=1S/C17H10Cl2O7/c1-7-4-8(14(20)21)2-3-9(7)16(24)26-17(25)11-6-12(18)10(15(22)23)5-13(11)19/h2-6H,1H3,(H,20,21)(H,22,23) |
| InChIKey | DRMOLEBDQQIGTJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|