C32H21NO7 — CID 159517620
12-(2,6-dimethylphenyl)-10-(C-hydroxycarbonimidoyl)perylene-3,4,9-tricarboxylic acid (PubChem CID 159517620) has the molecular formula C32H21NO7 and a molecular weight of 531.52 g/mol. Its IUPAC name is 12-(2,6-dimethylphenyl)-10-(C-hydroxycarbonimidoyl)perylene-3,4,9-tricarboxylic acid.
| Compound Name | 12-(2,6-dimethylphenyl)-10-(C-hydroxycarbonimidoyl)perylene-3,4,9-tricarboxylic acid |
|---|---|
| PubChem CID | 159517620 |
| Molecular Formula | C32H21NO7 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 12-(2,6-dimethylphenyl)-10-(C-hydroxycarbonimidoyl)perylene-3,4,9-tricarboxylic acid |
| SMILES | [H]/N=C(\O)c1cc(-c2c(C)cccc2C)c2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)O)c1c52)c43 |
| InChI | InChI=1S/C32H21NO7/c1-13-4-3-5-14(2)23(13)21-12-22(29(33)34)27-20(32(39)40)10-7-16-15-6-9-18(30(35)36)26-19(31(37)38)11-8-17(24(15)26)25(21)28(16)27/h3-12H,1-2H3,(H2,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | MBKDIWMILVJCRS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|