C26H14O6 — CID 163590088
15,17-dioxo-7-propanoyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid (PubChem CID 163590088) has the molecular formula C26H14O6 and a molecular weight of 422.39 g/mol. Its IUPAC name is 15,17-dioxo-7-propanoyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid.
| Compound Name | 15,17-dioxo-7-propanoyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
|---|---|
| PubChem CID | 163590088 |
| Molecular Formula | C26H14O6 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 15,17-dioxo-7-propanoyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
| SMILES | CCC(=O)c1ccc2c3ccc4c5c(ccc(c6ccc(C(=O)O)c1c62)c53)C(=O)OC4=O |
| InChI | InChI=1S/C26H14O6/c1-2-19(27)15-7-3-11-13-5-9-17-23-18(26(31)32-25(17)30)10-6-14(21(13)23)12-4-8-16(24(28)29)22(15)20(11)12/h3-10H,2H2,1H3,(H,28,29) |
| InChIKey | GOUBEOOWTHKTRQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|