C28H18NO5+ — CID 22886231
18-butyl-19-hydroxy-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione (PubChem CID 22886231) has the molecular formula C28H18NO5+ and a molecular weight of 448.45 g/mol. Its IUPAC name is 18-butyl-19-hydroxy-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione.
| Compound Name | 18-butyl-19-hydroxy-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione |
|---|---|
| PubChem CID | 22886231 |
| Molecular Formula | C28H18NO5+ |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 18-butyl-19-hydroxy-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione |
| SMILES | CCCC[N+]1=C(O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c73)C1=O)c64)C(=O)OC5=O |
| InChI | InChI=1S/C28H17NO5/c1-2-3-12-29-25(30)17-8-4-13-15-6-10-19-24-20(28(33)34-27(19)32)11-7-16(22(15)24)14-5-9-18(26(29)31)23(17)21(13)14/h4-11H,2-3,12H2,1H3/p+1 |
| InChIKey | BSBKILIPEXOKTC-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|