C29H20NO5+ — CID 22886230
19-hydroxy-18-pentyl-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione (PubChem CID 22886230) has the molecular formula C29H20NO5+ and a molecular weight of 462.48 g/mol. Its IUPAC name is 19-hydroxy-18-pentyl-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione.
| Compound Name | 19-hydroxy-18-pentyl-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione |
|---|---|
| PubChem CID | 22886230 |
| Molecular Formula | C29H20NO5+ |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 19-hydroxy-18-pentyl-7-oxa-18-azoniaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,18,20(24),21,25-undecaene-6,8,17-trione |
| SMILES | CCCCC[N+]1=C(O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c73)C1=O)c64)C(=O)OC5=O |
| InChI | InChI=1S/C29H19NO5/c1-2-3-4-13-30-26(31)18-9-5-14-16-7-11-20-25-21(29(34)35-28(20)33)12-8-17(23(16)25)15-6-10-19(27(30)32)24(18)22(14)15/h5-12H,2-4,13H2,1H3/p+1 |
| InChIKey | DUWRXYNTPBABSK-UHFFFAOYSA-O |
| XLogP | 5.71 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|