1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid

C17H16O6 — CID 20562968

IUPAC1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid
SMILESCCOC(=O)c1cccc2c(C(=O)OCC)c(C(=O)O)ccc12
InChIInChI=1S/C17H16O6/c1-3-22-16(20)12-7-5-6-11-10(12)8-9-13(15(18)19)14(11)17(21)23-4-2/h5-9H,3-4H2,1-2H3,(H,18,19)
InChIKeyOIMUKVYHROFKHW-UHFFFAOYSA-N
MW316.31 g/mol
LogP2.89
Rot. Bonds5

About 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid

1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid (PubChem CID 20562968) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid
PubChem CID20562968
Molecular FormulaC17H16O6
Molecular Weight316.31 g/mol
Exact Mass316.09
IUPAC Name1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid
SMILESCCOC(=O)c1cccc2c(C(=O)OCC)c(C(=O)O)ccc12
InChIInChI=1S/C17H16O6/c1-3-22-16(20)12-7-5-6-11-10(12)8-9-13(15(18)19)14(11)17(21)23-4-2/h5-9H,3-4H2,1-2H3,(H,18,19)
InChIKeyOIMUKVYHROFKHW-UHFFFAOYSA-N
XLogP2.89
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.31
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid?
The IUPAC name of 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid (CID 20562968) is 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid.
What is the SMILES notation for 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid?
The canonical SMILES for 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid is CCOC(=O)c1cccc2c(C(=O)OCC)c(C(=O)O)ccc12.
What is the InChIKey of 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid?
The InChIKey is OIMUKVYHROFKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O6/c1-3-22-16(20)12-7-5-6-11-10(12)8-9-13(15(18)19)14(11)17(21)23-4-2/h5-9H,3-4H2,1-2H3,(H,18,19).
What are the key properties of 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid?
1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid has a molecular weight of 316.31 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid is sourced from PubChem (CID 20562968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).