C17H16O6 — CID 20562968
1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid (PubChem CID 20562968) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid.
| Compound Name | 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 20562968 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1,5-bis(ethoxycarbonyl)naphthalene-2-carboxylic acid |
| SMILES | CCOC(=O)c1cccc2c(C(=O)OCC)c(C(=O)O)ccc12 |
| InChI | InChI=1S/C17H16O6/c1-3-22-16(20)12-7-5-6-11-10(12)8-9-13(15(18)19)14(11)17(21)23-4-2/h5-9H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | OIMUKVYHROFKHW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |