C18H22FNOS — CID 69188067
2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone (PubChem CID 69188067) has the molecular formula C18H22FNOS and a molecular weight of 319.44 g/mol. Its IUPAC name is 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone.
| Compound Name | 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 69188067 |
| Molecular Formula | C18H22FNOS |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone |
| SMILES | CCCCN1C(=CC(=O)c2cc(F)ccc2C)SC(C)=C1C |
| InChI | InChI=1S/C18H22FNOS/c1-5-6-9-20-13(3)14(4)22-18(20)11-17(21)16-10-15(19)8-7-12(16)2/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | AEDZVAWKLIIBQX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|