C18H18ClNOS2 — CID 24955694
(2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(3-chloro-1-benzothiophen-2-yl)ethanone (PubChem CID 24955694) has the molecular formula C18H18ClNOS2 and a molecular weight of 363.94 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(3-chloro-1-benzothiophen-2-yl)ethanone.
| Compound Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(3-chloro-1-benzothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 24955694 |
| Molecular Formula | C18H18ClNOS2 |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(3-chloro-1-benzothiophen-2-yl)ethanone |
| SMILES | CCCCN1C(C)=CS/C1=C\C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H18ClNOS2/c1-3-4-9-20-12(2)11-22-16(20)10-14(21)18-17(19)13-7-5-6-8-15(13)23-18/h5-8,10-11H,3-4,9H2,1-2H3/b16-10- |
| InChIKey | ABTRIYBMZAXSPS-YBEGLDIGSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|