C15H16Cl2N2OS — CID 24956780
(2Z)-2-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-1-(3,5-dichlorophenyl)ethanone (PubChem CID 24956780) has the molecular formula C15H16Cl2N2OS and a molecular weight of 343.28 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-1-(3,5-dichlorophenyl)ethanone.
| Compound Name | (2Z)-2-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-1-(3,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 24956780 |
| Molecular Formula | C15H16Cl2N2OS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (2Z)-2-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-1-(3,5-dichlorophenyl)ethanone |
| SMILES | CCCCN1N=C(C)S/C1=C\C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2OS/c1-3-4-5-19-15(21-10(2)18-19)9-14(20)11-6-12(16)8-13(17)7-11/h6-9H,3-5H2,1-2H3/b15-9- |
| InChIKey | UHAHCDBCUYJDSM-DHDCSXOGSA-N |
| XLogP | 5.20 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|