C15H24N2OS — CID 69323970
(1Z)-1-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-3-cyclopentylpropan-2-one (PubChem CID 69323970) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is (1Z)-1-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-3-cyclopentylpropan-2-one.
| Compound Name | (1Z)-1-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-3-cyclopentylpropan-2-one |
|---|---|
| PubChem CID | 69323970 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (1Z)-1-(3-butyl-5-methyl-1,3,4-thiadiazol-2-ylidene)-3-cyclopentylpropan-2-one |
| SMILES | CCCCN1N=C(C)S/C1=C\C(=O)CC1CCCC1 |
| InChI | InChI=1S/C15H24N2OS/c1-3-4-9-17-15(19-12(2)16-17)11-14(18)10-13-7-5-6-8-13/h11,13H,3-10H2,1-2H3/b15-11- |
| InChIKey | MLHGTWKLGLHPNO-PTNGSMBKSA-N |
| XLogP | 4.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|