About 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one
2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one (PubChem CID 61381918) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one.
Analyze 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The IUPAC name of 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one (CID 61381918) is 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one.
What is the SMILES notation for 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The canonical SMILES for 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one is CCCCN1N=C2CCCC2C1=O.
What is the InChIKey of 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The InChIKey is XQYRUUGOCXHYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-7-12-10(13)8-5-4-6-9(8)11-12/h8H,2-7H2,1H3.
What are the key properties of 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one has a molecular weight of 180.25 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one is sourced from PubChem (CID 61381918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).