C14H22N2O4 — CID 139680162
4-(1,3-dioxolan-2-ylmethyl)-2-(2-hydroxyethyl)-4,4a,5,6,7,8-hexahydrocinnolin-3-one (PubChem CID 139680162) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-ylmethyl)-2-(2-hydroxyethyl)-4,4a,5,6,7,8-hexahydrocinnolin-3-one.
| Compound Name | 4-(1,3-dioxolan-2-ylmethyl)-2-(2-hydroxyethyl)-4,4a,5,6,7,8-hexahydrocinnolin-3-one |
|---|---|
| PubChem CID | 139680162 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-(1,3-dioxolan-2-ylmethyl)-2-(2-hydroxyethyl)-4,4a,5,6,7,8-hexahydrocinnolin-3-one |
| SMILES | O=C1C(CC2OCCO2)C2CCCCC2=NN1CCO |
| InChI | InChI=1S/C14H22N2O4/c17-6-5-16-14(18)11(9-13-19-7-8-20-13)10-3-1-2-4-12(10)15-16/h10-11,13,17H,1-9H2 |
| InChIKey | LWPARQBIDCDZDS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |