C11H18N2O — CID 61382682
2-butan-2-yl-4,5,6,7-tetrahydro-3aH-indazol-3-one (PubChem CID 61382682) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-butan-2-yl-4,5,6,7-tetrahydro-3aH-indazol-3-one.
| Compound Name | 2-butan-2-yl-4,5,6,7-tetrahydro-3aH-indazol-3-one |
|---|---|
| PubChem CID | 61382682 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-butan-2-yl-4,5,6,7-tetrahydro-3aH-indazol-3-one |
| SMILES | CCC(C)N1N=C2CCCCC2C1=O |
| InChI | InChI=1S/C11H18N2O/c1-3-8(2)13-11(14)9-6-4-5-7-10(9)12-13/h8-9H,3-7H2,1-2H3 |
| InChIKey | ZOKHABONMAFRGF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |