C7H9NO2 — CID 12665307
4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-one (PubChem CID 12665307) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-one.
| Compound Name | 4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-one |
|---|---|
| PubChem CID | 12665307 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-3aH-2,1-benzoxazol-3-one |
| SMILES | O=C1ON=C2CCCCC12 |
| InChI | InChI=1S/C7H9NO2/c9-7-5-3-1-2-4-6(5)8-10-7/h5H,1-4H2 |
| InChIKey | DQKOZLPDUBCLKT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|