C8H11NO2 — CID 45099073
3-cyclopentyl-4H-1,2-oxazol-5-one (PubChem CID 45099073) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-cyclopentyl-4H-1,2-oxazol-5-one.
| Compound Name | 3-cyclopentyl-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 45099073 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-cyclopentyl-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(C2CCCC2)=NO1 |
| InChI | InChI=1S/C8H11NO2/c10-8-5-7(9-11-8)6-3-1-2-4-6/h6H,1-5H2 |
| InChIKey | RPMYHJXYOXFQKQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|