C10H15NO2 — CID 58226154
3-(cyclohexylmethyl)-4H-1,2-oxazol-5-one (PubChem CID 58226154) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(cyclohexylmethyl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 58226154 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(cyclohexylmethyl)-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(CC2CCCCC2)=NO1 |
| InChI | InChI=1S/C10H15NO2/c12-10-7-9(11-13-10)6-8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | OZOFZSMQUBIICV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|