C27H23N3O3S — CID 55733328
1-benzyl-3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 55733328) has the molecular formula C27H23N3O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 1-benzyl-3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55733328 |
| Molecular Formula | C27H23N3O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 1-benzyl-3-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1-c1nc(CN2C(=O)C(c3ccccc3)N(Cc3ccccc3)C2=O)cs1 |
| InChI | InChI=1S/C27H23N3O3S/c1-33-23-15-9-8-14-22(23)25-28-21(18-34-25)17-30-26(31)24(20-12-6-3-7-13-20)29(27(30)32)16-19-10-4-2-5-11-19/h2-15,18,24H,16-17H2,1H3 |
| InChIKey | OBIVFEFRAGTYFS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|