C21H20N4O5 — CID 92786855
(5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 92786855) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92786855 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | COc1ccc(-c2noc(CN3C(=O)N[C@@](C)(c4ccccc4)C3=O)n2)c(OC)c1 |
| InChI | InChI=1S/C21H20N4O5/c1-21(13-7-5-4-6-8-13)19(26)25(20(27)23-21)12-17-22-18(24-30-17)15-10-9-14(28-2)11-16(15)29-3/h4-11H,12H2,1-3H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | WNMVUXMFUPOIKO-NRFANRHFSA-N |
| XLogP | 2.72 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|