C21H28N4O5 — CID 97098327
(5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-hexyl-5-methylimidazolidine-2,4-dione (PubChem CID 97098327) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-hexyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97098327 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (5S)-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCC[C@]1(C)NC(=O)N(Cc2nc(-c3ccc(OC)cc3OC)no2)C1=O |
| InChI | InChI=1S/C21H28N4O5/c1-5-6-7-8-11-21(2)19(26)25(20(27)23-21)13-17-22-18(24-30-17)15-10-9-14(28-3)12-16(15)29-4/h9-10,12H,5-8,11,13H2,1-4H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | BLYMQOGLFLMPSE-NRFANRHFSA-N |
| XLogP | 3.53 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|