C20H26N4O5 — CID 32546193
3-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-dipropylimidazolidine-2,4-dione (PubChem CID 32546193) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-dipropylimidazolidine-2,4-dione.
| Compound Name | 3-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-dipropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 32546193 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5,5-dipropylimidazolidine-2,4-dione |
| SMILES | CCCC1(CCC)NC(=O)N(Cc2nc(-c3ccc(OC)c(OC)c3)no2)C1=O |
| InChI | InChI=1S/C20H26N4O5/c1-5-9-20(10-6-2)18(25)24(19(26)22-20)12-16-21-17(23-29-16)13-7-8-14(27-3)15(11-13)28-4/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,22,26) |
| InChIKey | RVGKGZUOSUUKEM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|