C22H20F2N4O3 — CID 18275723
5-butyl-5-(4-fluorophenyl)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione (PubChem CID 18275723) has the molecular formula C22H20F2N4O3 and a molecular weight of 426.42 g/mol. Its IUPAC name is 5-butyl-5-(4-fluorophenyl)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-butyl-5-(4-fluorophenyl)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18275723 |
| Molecular Formula | C22H20F2N4O3 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-butyl-5-(4-fluorophenyl)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CCCCC1(c2ccc(F)cc2)NC(=O)N(Cc2nc(-c3ccc(F)cc3)no2)C1=O |
| InChI | InChI=1S/C22H20F2N4O3/c1-2-3-12-22(15-6-10-17(24)11-7-15)20(29)28(21(30)26-22)13-18-25-19(27-31-18)14-4-8-16(23)9-5-14/h4-11H,2-3,12-13H2,1H3,(H,26,30) |
| InChIKey | VQKKNQLKIBAFNB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|