C24H26N4O5 — CID 55412063
5-butyl-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 55412063) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-butyl-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-butyl-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55412063 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 5-butyl-3-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(Cc2nc(-c3ccc(OC)cc3OC)no2)C1=O |
| InChI | InChI=1S/C24H26N4O5/c1-4-5-13-24(16-9-7-6-8-10-16)22(29)28(23(30)26-24)15-20-25-21(27-33-20)18-12-11-17(31-2)14-19(18)32-3/h6-12,14H,4-5,13,15H2,1-3H3,(H,26,30) |
| InChIKey | QYXPNVTWTXJFCG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|