C20H16Cl2N2O8S — CID 19590647
(4-nitrophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 19590647) has the molecular formula C20H16Cl2N2O8S and a molecular weight of 515.33 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 19590647 |
| Molecular Formula | C20H16Cl2N2O8S |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CCC(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H16Cl2N2O8S/c1-33(30,31)7-6-17(20(27)32-10-11-2-4-12(5-3-11)24(28)29)23-18(25)13-8-15(21)16(22)9-14(13)19(23)26/h2-5,8-9,17H,6-7,10H2,1H3 |
| InChIKey | YMOBIPRNTDFBJF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|