C20H16Cl3NO6S — CID 19615457
(4-chlorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 19615457) has the molecular formula C20H16Cl3NO6S and a molecular weight of 504.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | (4-chlorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 19615457 |
| Molecular Formula | C20H16Cl3NO6S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | (4-chlorophenyl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CCC(C(=O)OCc1ccc(Cl)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H16Cl3NO6S/c1-31(28,29)7-6-17(20(27)30-10-11-2-4-12(21)5-3-11)24-18(25)13-8-15(22)16(23)9-14(13)19(24)26/h2-5,8-9,17H,6-7,10H2,1H3 |
| InChIKey | SBBUVVPVYSEORG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|