C17H18Cl2N2O6S — CID 2204364
5,6-dichloro-2-[(2R)-4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 2204364) has the molecular formula C17H18Cl2N2O6S and a molecular weight of 449.31 g/mol. Its IUPAC name is 5,6-dichloro-2-[(2R)-4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[(2R)-4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2204364 |
| Molecular Formula | C17H18Cl2N2O6S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 5,6-dichloro-2-[(2R)-4-methylsulfonyl-1-morpholin-4-yl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)N1CCOCC1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C17H18Cl2N2O6S/c1-28(25,26)7-2-14(17(24)20-3-5-27-6-4-20)21-15(22)10-8-12(18)13(19)9-11(10)16(21)23/h8-9,14H,2-7H2,1H3/t14-/m1/s1 |
| InChIKey | QSRWMDXTJJJPLT-CQSZACIVSA-N |
| XLogP | 1.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|