C27H20Cl3NO7S — CID 126189145
[(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 126189145) has the molecular formula C27H20Cl3NO7S and a molecular weight of 608.88 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 126189145 |
| Molecular Formula | C27H20Cl3NO7S |
| Molecular Weight | 608.88 g/mol |
| Exact Mass | 607.00 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)O[C@H](C(=O)c1ccccc1)c1ccc(Cl)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C27H20Cl3NO7S/c1-39(36,37)12-11-22(31-25(33)18-13-20(29)21(30)14-19(18)26(31)34)27(35)38-24(16-7-9-17(28)10-8-16)23(32)15-5-3-2-4-6-15/h2-10,13-14,22,24H,11-12H2,1H3/t22-,24-/m0/s1 |
| InChIKey | PEQAVYAGKXXXBS-UPVQGACJSA-N |
| XLogP | 5.21 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|