C28H23Cl2NO8S — CID 126183443
[(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 126183443) has the molecular formula C28H23Cl2NO8S and a molecular weight of 604.46 g/mol. Its IUPAC name is [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 126183443 |
| Molecular Formula | C28H23Cl2NO8S |
| Molecular Weight | 604.46 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] (2R)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | COc1ccc(C(=O)[C@@H](OC(=O)[C@@H](CCS(C)(=O)=O)N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23Cl2NO8S/c1-38-18-10-8-16(9-11-18)24(32)25(17-6-4-3-5-7-17)39-28(35)23(12-13-40(2,36)37)31-26(33)19-14-21(29)22(30)15-20(19)27(31)34/h3-11,14-15,23,25H,12-13H2,1-2H3/t23-,25+/m1/s1 |
| InChIKey | CQYXKBRJSNEYQK-NOZRDPDXSA-N |
| XLogP | 4.57 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|